About ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate
ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate (PubChem CID 15833866) has the molecular formula C15H24O4
and a molecular weight of 268.35 g/mol. Its IUPAC name is ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate.
Analyze ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate?
The IUPAC name of ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate (CID 15833866) is ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate.
What is the SMILES notation for ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate?
The canonical SMILES for ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate is CCOC(=O)C1C[C@]2(CCCO2)C[C@@]2(CCCO2)C1.
What is the InChIKey of ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate?
The InChIKey is GNNJULTXUFGIHJ-HUUCEWRRSA-N. The full InChI is InChI=1S/C15H24O4/c1-2-17-13(16)12-9-14(5-3-7-18-14)11-15(10-12)6-4-8-19-15/h12H,2-11H2,1H3/t14-,15-/m1/s1.
What are the key properties of ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate?
ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate has a molecular weight of 268.35 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (5R,7R)-4,8-dioxadispiro[4.1.47.35]tetradecane-13-carboxylate is sourced from PubChem (CID 15833866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).