C18H27NO3S2 — CID 158339018
(2S)-3-methyl-2-[methyl-(5-sulfanylidene-8-thiophen-2-yloctanoyl)amino]butanoic acid (PubChem CID 158339018) has the molecular formula C18H27NO3S2 and a molecular weight of 369.55 g/mol. Its IUPAC name is (2S)-3-methyl-2-[methyl-(5-sulfanylidene-8-thiophen-2-yloctanoyl)amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[methyl-(5-sulfanylidene-8-thiophen-2-yloctanoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 158339018 |
| Molecular Formula | C18H27NO3S2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2S)-3-methyl-2-[methyl-(5-sulfanylidene-8-thiophen-2-yloctanoyl)amino]butanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(C)C(=O)CCCC(=S)CCCc1cccs1 |
| InChI | InChI=1S/C18H27NO3S2/c1-13(2)17(18(21)22)19(3)16(20)11-5-8-14(23)7-4-9-15-10-6-12-24-15/h6,10,12-13,17H,4-5,7-9,11H2,1-3H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | GQXYELLDEHRIHP-KRWDZBQOSA-N |
| XLogP | 4.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|