C25H24ClN5O — CID 158339669
4-(4-isocyanophenyl)-1-[1-(2-pyrrolidin-1-ylethyl)indazol-5-yl]pyridin-2-one;hydrochloride (PubChem CID 158339669) has the molecular formula C25H24ClN5O and a molecular weight of 445.95 g/mol. Its IUPAC name is 4-(4-isocyanophenyl)-1-[1-(2-pyrrolidin-1-ylethyl)indazol-5-yl]pyridin-2-one;hydrochloride.
| Compound Name | 4-(4-isocyanophenyl)-1-[1-(2-pyrrolidin-1-ylethyl)indazol-5-yl]pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 158339669 |
| Molecular Formula | C25H24ClN5O |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 4-(4-isocyanophenyl)-1-[1-(2-pyrrolidin-1-ylethyl)indazol-5-yl]pyridin-2-one;hydrochloride |
| SMILES | Cl.[C-]#[N+]c1ccc(-c2ccn(-c3ccc4c(cnn4CCN4CCCC4)c3)c(=O)c2)cc1 |
| InChI | InChI=1S/C25H23N5O.ClH/c1-26-22-6-4-19(5-7-22)20-10-13-29(25(31)17-20)23-8-9-24-21(16-23)18-27-30(24)15-14-28-11-2-3-12-28;/h4-10,13,16-18H,2-3,11-12,14-15H2;1H |
| InChIKey | BMIRECFNBWFJTI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|