About 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate
5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 158340292) has the molecular formula C15H8Br2F6N2O4
and a molecular weight of 554.04 g/mol. Its IUPAC name is 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate |
| PubChem CID | 158340292 |
| Molecular Formula | C15H8Br2F6N2O4 |
| Molecular Weight | 554.04 g/mol |
| Exact Mass | 551.88 |
| IUPAC Name | 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(Br)cnc1C(F)(F)F.O=C(O)c1cc(Br)cnc1C(F)(F)F |
| InChI | InChI=1S/C8H5BrF3NO2.C7H3BrF3NO2/c1-15-7(14)5-2-4(9)3-13-6(5)8(10,11)12;8-3-1-4(6(13)14)5(12-2-3)7(9,10)11/h2-3H,1H3;1-2H,(H,13,14) |
| InChIKey | GRBQTPJNKMZORJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.04 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate?
The IUPAC name of 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate (CID 158340292) is 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate.
What is the SMILES notation for 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate?
The canonical SMILES for 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate is COC(=O)c1cc(Br)cnc1C(F)(F)F.O=C(O)c1cc(Br)cnc1C(F)(F)F.
What is the InChIKey of 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate?
The InChIKey is GRBQTPJNKMZORJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrF3NO2.C7H3BrF3NO2/c1-15-7(14)5-2-4(9)3-13-6(5)8(10,11)12;8-3-1-4(6(13)14)5(12-2-3)7(9,10)11/h2-3H,1H3;1-2H,(H,13,14).
What are the key properties of 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate?
5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate has a molecular weight of 554.04 g/mol, XLogP of 5.21, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylic acid;methyl 5-bromo-2-(trifluoromethyl)pyridine-3-carboxylate is sourced from PubChem (CID 158340292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).