C39H36N4O3 — CID 158340457
7-isoquinolin-4-yl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one;7-(5-methoxy-3-pyridinyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one (PubChem CID 158340457) has the molecular formula C39H36N4O3 and a molecular weight of 608.74 g/mol. Its IUPAC name is 7-isoquinolin-4-yl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one;7-(5-methoxy-3-pyridinyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one.
| Compound Name | 7-isoquinolin-4-yl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one;7-(5-methoxy-3-pyridinyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
|---|---|
| PubChem CID | 158340457 |
| Molecular Formula | C39H36N4O3 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | 7-isoquinolin-4-yl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one;7-(5-methoxy-3-pyridinyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
| SMILES | COc1cncc(-c2cc3c4c(c2)CCC(=O)N4CCC3)c1.O=C1CCc2cc(-c3cncc4ccccc34)cc3c2N1CCC3 |
| InChI | InChI=1S/C21H18N2O.C18H18N2O2/c24-20-8-7-15-11-17(10-14-5-3-9-23(20)21(14)15)19-13-22-12-16-4-1-2-6-18(16)19;1-22-16-9-15(10-19-11-16)14-7-12-3-2-6-20-17(21)5-4-13(8-14)18(12)20/h1-2,4,6,10-13H,3,5,7-9H2;7-11H,2-6H2,1H3 |
| InChIKey | GRCFQMBWQMHBOE-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |