C4H24O8Si8 — CID 158341634
2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 158341634) has the molecular formula C4H24O8Si8 and a molecular weight of 424.92 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 158341634 |
| Molecular Formula | C4H24O8Si8 |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | 2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[SiH](C)O[SiH](C)O[SiH](C)O1.O1[SiH2]O[SiH2]O[SiH2]O[SiH2]1 |
| InChI | InChI=1S/C4H16O4Si4.H8O4Si4/c1-9-5-10(2)7-12(4)8-11(3)6-9;1-5-2-7-4-8-3-6-1/h9-12H,1-4H3;5-8H2 |
| InChIKey | GRFSMXAITCEOSR-UHFFFAOYSA-N |
| XLogP | -4.47 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|