C24H26N4O5 — CID 158341783
[1-(3-methoxyphenyl)-2-[4-[1-(oxan-2-yl)pyrazol-4-yl]anilino]-2-oxoethyl]carbamic acid (PubChem CID 158341783) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is [1-(3-methoxyphenyl)-2-[4-[1-(oxan-2-yl)pyrazol-4-yl]anilino]-2-oxoethyl]carbamic acid.
| Compound Name | [1-(3-methoxyphenyl)-2-[4-[1-(oxan-2-yl)pyrazol-4-yl]anilino]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 158341783 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [1-(3-methoxyphenyl)-2-[4-[1-(oxan-2-yl)pyrazol-4-yl]anilino]-2-oxoethyl]carbamic acid |
| SMILES | COc1cccc(C(NC(=O)O)C(=O)Nc2ccc(-c3cnn(C4CCCCO4)c3)cc2)c1 |
| InChI | InChI=1S/C24H26N4O5/c1-32-20-6-4-5-17(13-20)22(27-24(30)31)23(29)26-19-10-8-16(9-11-19)18-14-25-28(15-18)21-7-2-3-12-33-21/h4-6,8-11,13-15,21-22,27H,2-3,7,12H2,1H3,(H,26,29)(H,30,31) |
| InChIKey | GRGFIJAFSDTYQW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |