C12H20IrO2 — CID 158342787
carbon monoxide;iridium;1,2,3,4,5-pentamethylcyclopentane (PubChem CID 158342787) has the molecular formula C12H20IrO2 and a molecular weight of 388.51 g/mol. Its IUPAC name is carbon monoxide;iridium;1,2,3,4,5-pentamethylcyclopentane.
| Compound Name | carbon monoxide;iridium;1,2,3,4,5-pentamethylcyclopentane |
|---|---|
| PubChem CID | 158342787 |
| Molecular Formula | C12H20IrO2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | carbon monoxide;iridium;1,2,3,4,5-pentamethylcyclopentane |
| SMILES | CC1C(C)C(C)C(C)C1C.[C-]#[O+].[C-]#[O+].[Ir] |
| InChI | InChI=1S/C10H20.2CO.Ir/c1-6-7(2)9(4)10(5)8(6)3;2*1-2;/h6-10H,1-5H3;;; |
| InChIKey | FMGINASTHHHBGH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 39.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|