C15H22O3 — CID 15834289
(2S,4aR,6S,7aS,7bR)-2-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,4a,5,7,7a-hexahydrocyclobuta[e]inden-4-one (PubChem CID 15834289) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,4aR,6S,7aS,7bR)-2-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,4a,5,7,7a-hexahydrocyclobuta[e]inden-4-one.
| Compound Name | (2S,4aR,6S,7aS,7bR)-2-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,4a,5,7,7a-hexahydrocyclobuta[e]inden-4-one |
|---|---|
| PubChem CID | 15834289 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2S,4aR,6S,7aS,7bR)-2-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,4a,5,7,7a-hexahydrocyclobuta[e]inden-4-one |
| SMILES | CC1=C2[C@@H](O)C[C@]2(C)[C@H]2C[C@](C)(CO)C[C@H]2C1=O |
| InChI | InChI=1S/C15H22O3/c1-8-12-11(17)6-15(12,3)10-5-14(2,7-16)4-9(10)13(8)18/h9-11,16-17H,4-7H2,1-3H3/t9-,10+,11+,14-,15-/m1/s1 |
| InChIKey | JMCRLYORYXAMMG-CDYMVBJSSA-N |
| XLogP | 1.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |