C26H26O7 — CID 15834313
(10S,11R)-10-(4-hydroxy-3,5-dimethoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol (PubChem CID 15834313) has the molecular formula C26H26O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is (10S,11R)-10-(4-hydroxy-3,5-dimethoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol.
| Compound Name | (10S,11R)-10-(4-hydroxy-3,5-dimethoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol |
|---|---|
| PubChem CID | 15834313 |
| Molecular Formula | C26H26O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (10S,11R)-10-(4-hydroxy-3,5-dimethoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol |
| SMILES | COc1cc([C@H]2COc3cc4c(cc3[C@@H]2O)-c2c(cc(O)cc2OC)CC4)cc(OC)c1O |
| InChI | InChI=1S/C26H26O7/c1-30-21-10-16(27)6-14-5-4-13-7-20-18(11-17(13)24(14)21)25(28)19(12-33-20)15-8-22(31-2)26(29)23(9-15)32-3/h6-11,19,25,27-29H,4-5,12H2,1-3H3/t19-,25+/m1/s1 |
| InChIKey | UQRXDLDKKPPLEI-CLOONOSVSA-N |
| XLogP | 4.10 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |