C16H23NO4 — CID 158343233
benzyl (2S,3R,4S)-4-acetyloxy-3-methyl-2-(methylamino)pentanoate (PubChem CID 158343233) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is benzyl (2S,3R,4S)-4-acetyloxy-3-methyl-2-(methylamino)pentanoate.
| Compound Name | benzyl (2S,3R,4S)-4-acetyloxy-3-methyl-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 158343233 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | benzyl (2S,3R,4S)-4-acetyloxy-3-methyl-2-(methylamino)pentanoate |
| SMILES | CN[C@H](C(=O)OCc1ccccc1)[C@@H](C)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C16H23NO4/c1-11(12(2)21-13(3)18)15(17-4)16(19)20-10-14-8-6-5-7-9-14/h5-9,11-12,15,17H,10H2,1-4H3/t11-,12-,15-/m0/s1 |
| InChIKey | OUVCDXBSNUOCSH-HUBLWGQQSA-N |
| XLogP | 1.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |