C24H26Br2N2O5 — CID 158343674
6-bromo-8-hydroxy-3,4-dihydro-1H-quinolin-2-one;6-bromo-8-(oxan-3-ylmethoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 158343674) has the molecular formula C24H26Br2N2O5 and a molecular weight of 582.29 g/mol. Its IUPAC name is 6-bromo-8-hydroxy-3,4-dihydro-1H-quinolin-2-one;6-bromo-8-(oxan-3-ylmethoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-bromo-8-hydroxy-3,4-dihydro-1H-quinolin-2-one;6-bromo-8-(oxan-3-ylmethoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 158343674 |
| Molecular Formula | C24H26Br2N2O5 |
| Molecular Weight | 582.29 g/mol |
| Exact Mass | 580.02 |
| IUPAC Name | 6-bromo-8-hydroxy-3,4-dihydro-1H-quinolin-2-one;6-bromo-8-(oxan-3-ylmethoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(Br)cc(O)c2N1.O=C1CCc2cc(Br)cc(OCC3CCCOC3)c2N1 |
| InChI | InChI=1S/C15H18BrNO3.C9H8BrNO2/c16-12-6-11-3-4-14(18)17-15(11)13(7-12)20-9-10-2-1-5-19-8-10;10-6-3-5-1-2-8(13)11-9(5)7(12)4-6/h6-7,10H,1-5,8-9H2,(H,17,18);3-4,12H,1-2H2,(H,11,13) |
| InChIKey | GRLSBQDGAOYDKA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.29 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|