About carbanide;4-heptoxybutylbenzene
carbanide;4-heptoxybutylbenzene (PubChem CID 158344773) has the molecular formula C18H31O-
and a molecular weight of 263.44 g/mol. Its IUPAC name is carbanide;4-heptoxybutylbenzene.
Molecular Properties
| Compound Name | carbanide;4-heptoxybutylbenzene |
| PubChem CID | 158344773 |
| Molecular Formula | C18H31O- |
| Molecular Weight | 263.44 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | carbanide;4-heptoxybutylbenzene |
| SMILES | CCCCCCCOCCCCc1ccccc1.[CH3-] |
| InChI | InChI=1S/C17H28O.CH3/c1-2-3-4-5-10-15-18-16-11-9-14-17-12-7-6-8-13-17;/h6-8,12-13H,2-5,9-11,14-16H2,1H3;1H3/q;-1 |
| InChIKey | GRPBUNODIYTFJM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;4-heptoxybutylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;4-heptoxybutylbenzene?
The IUPAC name of carbanide;4-heptoxybutylbenzene (CID 158344773) is carbanide;4-heptoxybutylbenzene.
What is the SMILES notation for carbanide;4-heptoxybutylbenzene?
The canonical SMILES for carbanide;4-heptoxybutylbenzene is CCCCCCCOCCCCc1ccccc1.[CH3-].
What is the InChIKey of carbanide;4-heptoxybutylbenzene?
The InChIKey is GRPBUNODIYTFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O.CH3/c1-2-3-4-5-10-15-18-16-11-9-14-17-12-7-6-8-13-17;/h6-8,12-13H,2-5,9-11,14-16H2,1H3;1H3/q;-1.
What are the key properties of carbanide;4-heptoxybutylbenzene?
carbanide;4-heptoxybutylbenzene has a molecular weight of 263.44 g/mol, XLogP of 5.45, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;4-heptoxybutylbenzene is sourced from PubChem (CID 158344773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).