C25H26F2N2O4 — CID 158345224
(4aR,8aS)-6-[3-[bis(4-fluorophenyl)-hydroxymethyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 158345224) has the molecular formula C25H26F2N2O4 and a molecular weight of 456.49 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-[bis(4-fluorophenyl)-hydroxymethyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[3-[bis(4-fluorophenyl)-hydroxymethyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 158345224 |
| Molecular Formula | C25H26F2N2O4 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (4aR,8aS)-6-[3-[bis(4-fluorophenyl)-hydroxymethyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CC(C(O)(c4ccc(F)cc4)c4ccc(F)cc4)C3)C[C@H]2C1 |
| InChI | InChI=1S/C25H26F2N2O4/c26-20-5-1-17(2-6-20)25(32,18-3-7-21(27)8-4-18)19-13-29(14-19)24(31)28-10-9-23-16(12-28)11-22(30)15-33-23/h1-8,16,19,23,32H,9-15H2/t16-,23+/m1/s1 |
| InChIKey | GRQNVPNPOUNZEZ-MWTRTKDXSA-N |
| XLogP | 2.93 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |