C23H19ClF4N3NaO2 — CID 158345400
sodium 4-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-6-(4-fluoro-3-methylphenyl)-1,3,5-triazin-2-olate (PubChem CID 158345400) has the molecular formula C23H19ClF4N3NaO2 and a molecular weight of 503.86 g/mol. Its IUPAC name is sodium 4-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-6-(4-fluoro-3-methylphenyl)-1,3,5-triazin-2-olate.
| Compound Name | sodium 4-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-6-(4-fluoro-3-methylphenyl)-1,3,5-triazin-2-olate |
|---|---|
| PubChem CID | 158345400 |
| Molecular Formula | C23H19ClF4N3NaO2 |
| Molecular Weight | 503.86 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | sodium 4-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-6-(4-fluoro-3-methylphenyl)-1,3,5-triazin-2-olate |
| SMILES | Cc1cc(-c2nc([O-])nc(-c3cc(CCC(=O)C(C)(C)C(F)(F)F)ccc3Cl)n2)ccc1F.[Na+] |
| InChI | InChI=1S/C23H20ClF4N3O2.Na/c1-12-10-14(6-8-17(12)25)19-29-20(31-21(33)30-19)15-11-13(4-7-16(15)24)5-9-18(32)22(2,3)23(26,27)28;/h4,6-8,10-11H,5,9H2,1-3H3,(H,29,30,31,33);/q;+1/p-1 |
| InChIKey | GNOSYZDPGXYQQR-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 78.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.86 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |