C24H30N2O5 — CID 158345725
6-ethenyl-4-[(Z)-2-[6-ethenyl-2-(2-methoxyethyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-4-yl]ethenyl]-2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 158345725) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 6-ethenyl-4-[(Z)-2-[6-ethenyl-2-(2-methoxyethyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-4-yl]ethenyl]-2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 6-ethenyl-4-[(Z)-2-[6-ethenyl-2-(2-methoxyethyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-4-yl]ethenyl]-2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 158345725 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 6-ethenyl-4-[(Z)-2-[6-ethenyl-2-(2-methoxyethyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-4-yl]ethenyl]-2-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | C=CC1CC(/C=C\C2CC(C=C)C3C(=O)N(CCOC)C(=O)C23)C2C(=O)N(C)C(=O)C12 |
| InChI | InChI=1S/C24H30N2O5/c1-5-13-11-15(19-17(13)21(27)25(3)22(19)28)7-8-16-12-14(6-2)18-20(16)24(30)26(23(18)29)9-10-31-4/h5-8,13-20H,1-2,9-12H2,3-4H3/b8-7- |
| InChIKey | FNJDSIAUPQJAGR-FPLPWBNLSA-N |
| XLogP | 1.67 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|