C32H35ClN10O8 — CID 158346291
ethyl N-(2-amino-6-chloro-3-nitro-4-pyridinyl)-N-[(6-methyl-3-pyridinyl)methyl]carbamate;ethyl N-(2-amino-6-ethenyl-3-nitro-4-pyridinyl)-N-[(6-methyl-3-pyridinyl)methyl]carbamate (PubChem CID 158346291) has the molecular formula C32H35ClN10O8 and a molecular weight of 723.15 g/mol. Its IUPAC name is ethyl N-(2-amino-6-chloro-3-nitro-4-pyridinyl)-N-[(6-methyl-3-pyridinyl)methyl]carbamate;ethyl N-(2-amino-6-ethenyl-3-nitro-4-pyridinyl)-N-[(6-methyl-3-pyridinyl)methyl]carbamate.
| Compound Name | ethyl N-(2-amino-6-chloro-3-nitro-4-pyridinyl)-N-[(6-methyl-3-pyridinyl)methyl]carbamate;ethyl N-(2-amino-6-ethenyl-3-nitro-4-pyridinyl)-N-[(6-methyl-3-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 158346291 |
| Molecular Formula | C32H35ClN10O8 |
| Molecular Weight | 723.15 g/mol |
| Exact Mass | 722.23 |
| IUPAC Name | ethyl N-(2-amino-6-chloro-3-nitro-4-pyridinyl)-N-[(6-methyl-3-pyridinyl)methyl]carbamate;ethyl N-(2-amino-6-ethenyl-3-nitro-4-pyridinyl)-N-[(6-methyl-3-pyridinyl)methyl]carbamate |
| SMILES | C=Cc1cc(N(Cc2ccc(C)nc2)C(=O)OCC)c([N+](=O)[O-])c(N)n1.CCOC(=O)N(Cc1ccc(C)nc1)c1cc(Cl)nc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19N5O4.C15H16ClN5O4/c1-4-13-8-14(15(22(24)25)16(18)20-13)21(17(23)26-5-2)10-12-7-6-11(3)19-9-12;1-3-25-15(22)20(8-10-5-4-9(2)18-7-10)11-6-12(16)19-14(17)13(11)21(23)24/h4,6-9H,1,5,10H2,2-3H3,(H2,18,20);4-7H,3,8H2,1-2H3,(H2,17,19) |
| InChIKey | GRTSWFGNTBLCCO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 248.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.15 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|