C23H27FO4S — CID 158347405
(3aS,4R,6S,7R,7aS)-4-ethyl-7-[(4-fluorophenyl)methoxy]-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 158347405) has the molecular formula C23H27FO4S and a molecular weight of 418.53 g/mol. Its IUPAC name is (3aS,4R,6S,7R,7aS)-4-ethyl-7-[(4-fluorophenyl)methoxy]-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aS,4R,6S,7R,7aS)-4-ethyl-7-[(4-fluorophenyl)methoxy]-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 158347405 |
| Molecular Formula | C23H27FO4S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (3aS,4R,6S,7R,7aS)-4-ethyl-7-[(4-fluorophenyl)methoxy]-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CC[C@H]1O[C@@H](Sc2ccccc2)[C@H](OCc2ccc(F)cc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C23H27FO4S/c1-4-18-19-20(28-23(2,3)27-19)21(25-14-15-10-12-16(24)13-11-15)22(26-18)29-17-8-6-5-7-9-17/h5-13,18-22H,4,14H2,1-3H3/t18-,19+,20+,21-,22+/m1/s1 |
| InChIKey | GRXBITULRQPKMX-CTWRKMMKSA-N |
| XLogP | 5.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |