About 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane
3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane (PubChem CID 158348981) has the molecular formula C10H17N2O4P
and a molecular weight of 260.23 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane |
| PubChem CID | 158348981 |
| Molecular Formula | C10H17N2O4P |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane |
| SMILES | C.CN1CC(C(=O)O)(N2C(=O)C=CC2=O)C1.P |
| InChI | InChI=1S/C9H10N2O4.CH4.H3P/c1-10-4-9(5-10,8(14)15)11-6(12)2-3-7(11)13;;/h2-3H,4-5H2,1H3,(H,14,15);1H4;1H3 |
| InChIKey | GSBVBJWMGXTUOB-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane (CID 158348981) is 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane is C.CN1CC(C(=O)O)(N2C(=O)C=CC2=O)C1.P.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane?
The InChIKey is GSBVBJWMGXTUOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4.CH4.H3P/c1-10-4-9(5-10,8(14)15)11-6(12)2-3-7(11)13;;/h2-3H,4-5H2,1H3,(H,14,15);1H4;1H3.
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane?
3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane has a molecular weight of 260.23 g/mol, XLogP of -0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)-1-methylazetidine-3-carboxylic acid;methane;phosphane is sourced from PubChem (CID 158348981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).