About N-(4-aminopenta-2,4-dienoyl)octanamide
N-(4-aminopenta-2,4-dienoyl)octanamide (PubChem CID 158349493) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is N-(4-aminopenta-2,4-dienoyl)octanamide.
Molecular Properties
| Compound Name | N-(4-aminopenta-2,4-dienoyl)octanamide |
| PubChem CID | 158349493 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N-(4-aminopenta-2,4-dienoyl)octanamide |
| SMILES | C=C(N)C=CC(=O)NC(=O)CCCCCCC |
| InChI | InChI=1S/C13H22N2O2/c1-3-4-5-6-7-8-12(16)15-13(17)10-9-11(2)14/h9-10H,2-8,14H2,1H3,(H,15,16,17) |
| InChIKey | GSDHXCROUFCDEQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminopenta-2,4-dienoyl)octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminopenta-2,4-dienoyl)octanamide?
The IUPAC name of N-(4-aminopenta-2,4-dienoyl)octanamide (CID 158349493) is N-(4-aminopenta-2,4-dienoyl)octanamide.
What is the SMILES notation for N-(4-aminopenta-2,4-dienoyl)octanamide?
The canonical SMILES for N-(4-aminopenta-2,4-dienoyl)octanamide is C=C(N)C=CC(=O)NC(=O)CCCCCCC.
What is the InChIKey of N-(4-aminopenta-2,4-dienoyl)octanamide?
The InChIKey is GSDHXCROUFCDEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-3-4-5-6-7-8-12(16)15-13(17)10-9-11(2)14/h9-10H,2-8,14H2,1H3,(H,15,16,17).
What are the key properties of N-(4-aminopenta-2,4-dienoyl)octanamide?
N-(4-aminopenta-2,4-dienoyl)octanamide has a molecular weight of 238.33 g/mol, XLogP of 2.02, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminopenta-2,4-dienoyl)octanamide is sourced from PubChem (CID 158349493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).