C10H9F3N4O6S2 — CID 158350072
4,6-diaminobenzene-1,3-disulfonic acid;4,5,6-trifluoropyrimidine (PubChem CID 158350072) has the molecular formula C10H9F3N4O6S2 and a molecular weight of 402.33 g/mol. Its IUPAC name is 4,6-diaminobenzene-1,3-disulfonic acid;4,5,6-trifluoropyrimidine.
| Compound Name | 4,6-diaminobenzene-1,3-disulfonic acid;4,5,6-trifluoropyrimidine |
|---|---|
| PubChem CID | 158350072 |
| Molecular Formula | C10H9F3N4O6S2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 4,6-diaminobenzene-1,3-disulfonic acid;4,5,6-trifluoropyrimidine |
| SMILES | Fc1ncnc(F)c1F.Nc1cc(N)c(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C6H8N2O6S2.C4HF3N2/c7-3-1-4(8)6(16(12,13)14)2-5(3)15(9,10)11;5-2-3(6)8-1-9-4(2)7/h1-2H,7-8H2,(H,9,10,11)(H,12,13,14);1H |
| InChIKey | GSEXBLICNOINDD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 186.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|