C14H18O7S — CID 15835033
[(1R,4R,5R,6S)-5,6-diacetyloxy-4-acetylsulfanylcyclohex-2-en-1-yl] acetate (PubChem CID 15835033) has the molecular formula C14H18O7S and a molecular weight of 330.36 g/mol. Its IUPAC name is [(1R,4R,5R,6S)-5,6-diacetyloxy-4-acetylsulfanylcyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,4R,5R,6S)-5,6-diacetyloxy-4-acetylsulfanylcyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 15835033 |
| Molecular Formula | C14H18O7S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [(1R,4R,5R,6S)-5,6-diacetyloxy-4-acetylsulfanylcyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](SC(C)=O)C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H18O7S/c1-7(15)19-11-5-6-12(22-10(4)18)14(21-9(3)17)13(11)20-8(2)16/h5-6,11-14H,1-4H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | ITUMFALOLBZZPQ-MQYQWHSLSA-N |
| XLogP | 1.00 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|