About benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide
benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide (PubChem CID 158350382) has the molecular formula C12H17BrN2
and a molecular weight of 269.19 g/mol. Its IUPAC name is benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide.
Molecular Properties
| Compound Name | benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide |
| PubChem CID | 158350382 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide |
| SMILES | Br.C[C@H]1CCCN1.N#Cc1ccccc1 |
| InChI | InChI=1S/C7H5N.C5H11N.BrH/c8-6-7-4-2-1-3-5-7;1-5-3-2-4-6-5;/h1-5H;5-6H,2-4H2,1H3;1H/t;5-;/m.0./s1 |
| InChIKey | JBMPMHIFHPKIJD-NXAOXGSFSA-N |
| XLogP | 2.89 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide?
The IUPAC name of benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide (CID 158350382) is benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide.
What is the SMILES notation for benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide?
The canonical SMILES for benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide is Br.C[C@H]1CCCN1.N#Cc1ccccc1.
What is the InChIKey of benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide?
The InChIKey is JBMPMHIFHPKIJD-NXAOXGSFSA-N. The full InChI is InChI=1S/C7H5N.C5H11N.BrH/c8-6-7-4-2-1-3-5-7;1-5-3-2-4-6-5;/h1-5H;5-6H,2-4H2,1H3;1H/t;5-;/m.0./s1.
What are the key properties of benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide?
benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide has a molecular weight of 269.19 g/mol, XLogP of 2.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;(2S)-2-methylpyrrolidine;hydrobromide is sourced from PubChem (CID 158350382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).