C38H40F6N10 — CID 158350898
5-[5-[(1R,5S)-3-isocyano-6-bicyclo[3.1.0]hexanyl]-1-propan-2-ylpyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 158350898) has the molecular formula C38H40F6N10 and a molecular weight of 750.80 g/mol. Its IUPAC name is 5-[5-[(1R,5S)-3-isocyano-6-bicyclo[3.1.0]hexanyl]-1-propan-2-ylpyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[5-[(1R,5S)-3-isocyano-6-bicyclo[3.1.0]hexanyl]-1-propan-2-ylpyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 158350898 |
| Molecular Formula | C38H40F6N10 |
| Molecular Weight | 750.80 g/mol |
| Exact Mass | 750.33 |
| IUPAC Name | 5-[5-[(1R,5S)-3-isocyano-6-bicyclo[3.1.0]hexanyl]-1-propan-2-ylpyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | [C-]#[N+]C1C[C@@H]2C(c3cc(-c4cnc(N)c(C(F)(F)F)c4)nn3C(C)C)[C@@H]2C1.[C-]#[N+]C1C[C@@H]2C(c3cc(-c4cnc(N)c(C(F)(F)F)c4)nn3C(C)C)[C@@H]2C1 |
| InChI | InChI=1S/2C19H20F3N5/c2*1-9(2)27-16(17-12-5-11(24-3)6-13(12)17)7-15(26-27)10-4-14(19(20,21)22)18(23)25-8-10/h2*4,7-9,11-13,17H,5-6H2,1-2H3,(H2,23,25)/t2*11?,12-,13+,17? |
| InChIKey | GSHPKMMLNLJGJJ-XIAMVCEBSA-N |
| XLogP | 9.08 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.80 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|