C29H25ClF3N3O3 — CID 158351570
3-[[5-[5-[3-methyl-4-(2,3,6-trifluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]cyclobutane-1-carboxylic acid;hydrochloride (PubChem CID 158351570) has the molecular formula C29H25ClF3N3O3 and a molecular weight of 555.98 g/mol. Its IUPAC name is 3-[[5-[5-[3-methyl-4-(2,3,6-trifluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]cyclobutane-1-carboxylic acid;hydrochloride.
| Compound Name | 3-[[5-[5-[3-methyl-4-(2,3,6-trifluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]cyclobutane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 158351570 |
| Molecular Formula | C29H25ClF3N3O3 |
| Molecular Weight | 555.98 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 3-[[5-[5-[3-methyl-4-(2,3,6-trifluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]cyclobutane-1-carboxylic acid;hydrochloride |
| SMILES | Cc1cc(-c2nc(-c3ccc4c(c3)CCC4NC3CC(C(=O)O)C3)no2)ccc1-c1c(F)ccc(F)c1F.Cl |
| InChI | InChI=1S/C29H24F3N3O3.ClH/c1-14-10-17(3-5-20(14)25-22(30)7-8-23(31)26(25)32)28-34-27(35-38-28)16-2-6-21-15(11-16)4-9-24(21)33-19-12-18(13-19)29(36)37;/h2-3,5-8,10-11,18-19,24,33H,4,9,12-13H2,1H3,(H,36,37);1H |
| InChIKey | LNKUIJGFYCPIIV-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.98 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|