C39H48N4O4S2Si — CID 158352727
2-[4-(benzylamino)-3-ethynylphenyl]-N-methylethanesulfonamide;2-[4-(benzylamino)-3-(2-trimethylsilylethynyl)phenyl]-N-methylethanesulfonamide (PubChem CID 158352727) has the molecular formula C39H48N4O4S2Si and a molecular weight of 729.06 g/mol. Its IUPAC name is 2-[4-(benzylamino)-3-ethynylphenyl]-N-methylethanesulfonamide;2-[4-(benzylamino)-3-(2-trimethylsilylethynyl)phenyl]-N-methylethanesulfonamide.
| Compound Name | 2-[4-(benzylamino)-3-ethynylphenyl]-N-methylethanesulfonamide;2-[4-(benzylamino)-3-(2-trimethylsilylethynyl)phenyl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 158352727 |
| Molecular Formula | C39H48N4O4S2Si |
| Molecular Weight | 729.06 g/mol |
| Exact Mass | 728.29 |
| IUPAC Name | 2-[4-(benzylamino)-3-ethynylphenyl]-N-methylethanesulfonamide;2-[4-(benzylamino)-3-(2-trimethylsilylethynyl)phenyl]-N-methylethanesulfonamide |
| SMILES | C#Cc1cc(CCS(=O)(=O)NC)ccc1NCc1ccccc1.CNS(=O)(=O)CCc1ccc(NCc2ccccc2)c(C#C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C21H28N2O2SSi.C18H20N2O2S/c1-22-26(24,25)14-12-18-10-11-21(20(16-18)13-15-27(2,3)4)23-17-19-8-6-5-7-9-19;1-3-17-13-15(11-12-23(21,22)19-2)9-10-18(17)20-14-16-7-5-4-6-8-16/h5-11,16,22-23H,12,14,17H2,1-4H3;1,4-10,13,19-20H,11-12,14H2,2H3 |
| InChIKey | GSMYJPJBHQWOTM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.06 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|