C25H20Cl2N2O4 — CID 158353844
2,4-dichloro-6-(methyliminomethyl)phenol;2-(4-propanoylphenyl)isoindole-1,3-dione (PubChem CID 158353844) has the molecular formula C25H20Cl2N2O4 and a molecular weight of 483.35 g/mol. Its IUPAC name is 2,4-dichloro-6-(methyliminomethyl)phenol;2-(4-propanoylphenyl)isoindole-1,3-dione.
| Compound Name | 2,4-dichloro-6-(methyliminomethyl)phenol;2-(4-propanoylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 158353844 |
| Molecular Formula | C25H20Cl2N2O4 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2,4-dichloro-6-(methyliminomethyl)phenol;2-(4-propanoylphenyl)isoindole-1,3-dione |
| SMILES | C/N=C/c1cc(Cl)cc(Cl)c1O.CCC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H13NO3.C8H7Cl2NO/c1-2-15(19)11-7-9-12(10-8-11)18-16(20)13-5-3-4-6-14(13)17(18)21;1-11-4-5-2-6(9)3-7(10)8(5)12/h3-10H,2H2,1H3;2-4,12H,1H3/b;11-4+ |
| InChIKey | GSQIAEPEHODACH-ANTNIJRQSA-N |
| XLogP | 5.83 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|