About 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium
3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium (PubChem CID 158354276) has the molecular formula C14H32NO2Y-
and a molecular weight of 335.32 g/mol. Its IUPAC name is 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium.
Molecular Properties
| Compound Name | 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium |
| PubChem CID | 158354276 |
| Molecular Formula | C14H32NO2Y- |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium |
| SMILES | COC(C)C(C)(C)C.C[N-]C(C)(C)C(C)OC.[Y] |
| InChI | InChI=1S/C7H16NO.C7H16O.Y/c1-6(9-5)7(2,3)8-4;1-6(8-5)7(2,3)4;/h6H,1-5H3;6H,1-5H3;/q-1;; |
| InChIKey | QVTJSKAGZJJKNY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 32.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium?
The IUPAC name of 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium (CID 158354276) is 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium.
What is the SMILES notation for 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium?
The canonical SMILES for 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium is COC(C)C(C)(C)C.C[N-]C(C)(C)C(C)OC.[Y].
What is the InChIKey of 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium?
The InChIKey is QVTJSKAGZJJKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16NO.C7H16O.Y/c1-6(9-5)7(2,3)8-4;1-6(8-5)7(2,3)4;/h6H,1-5H3;6H,1-5H3;/q-1;;.
What are the key properties of 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium?
3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium has a molecular weight of 335.32 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,2-dimethylbutane;(3-methoxy-2-methylbutan-2-yl)-methylazanide;yttrium is sourced from PubChem (CID 158354276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).