About (E)-hex-4-en-2-imine
(E)-hex-4-en-2-imine (PubChem CID 15835471) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is (E)-hex-4-en-2-imine.
Molecular Properties
| Compound Name | (E)-hex-4-en-2-imine |
| PubChem CID | 15835471 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | (E)-hex-4-en-2-imine |
| SMILES | [H]/N=C(\C)C/C=C/C |
| InChI | InChI=1S/C6H11N/c1-3-4-5-6(2)7/h3-4,7H,5H2,1-2H3/b4-3+,7-6+ |
| InChIKey | SMXJWSJSNMOLSC-FZWLCVONSA-N |
| XLogP | 1.99 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-hex-4-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hex-4-en-2-imine?
The IUPAC name of (E)-hex-4-en-2-imine (CID 15835471) is (E)-hex-4-en-2-imine.
What is the SMILES notation for (E)-hex-4-en-2-imine?
The canonical SMILES for (E)-hex-4-en-2-imine is [H]/N=C(\C)C/C=C/C.
What is the InChIKey of (E)-hex-4-en-2-imine?
The InChIKey is SMXJWSJSNMOLSC-FZWLCVONSA-N. The full InChI is InChI=1S/C6H11N/c1-3-4-5-6(2)7/h3-4,7H,5H2,1-2H3/b4-3+,7-6+.
What are the key properties of (E)-hex-4-en-2-imine?
(E)-hex-4-en-2-imine has a molecular weight of 97.16 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hex-4-en-2-imine is sourced from PubChem (CID 15835471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).