C13H12N2O — CID 158354992
5-phenyl-3-pyrrol-1-yl-4,5-dihydro-1,2-oxazole (PubChem CID 158354992) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-phenyl-3-pyrrol-1-yl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-phenyl-3-pyrrol-1-yl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 158354992 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 5-phenyl-3-pyrrol-1-yl-4,5-dihydro-1,2-oxazole |
| SMILES | c1ccc(C2CC(n3cccc3)=NO2)cc1 |
| InChI | InChI=1S/C13H12N2O/c1-2-6-11(7-3-1)12-10-13(14-16-12)15-8-4-5-9-15/h1-9,12H,10H2 |
| InChIKey | GSTLNPKZTBDTBL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |