C24H27FN3O6PS — CID 158355385
1-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-[4-[diethoxyphosphoryl(fluoro)methyl]sulfonylphenyl]ethanone (PubChem CID 158355385) has the molecular formula C24H27FN3O6PS and a molecular weight of 535.53 g/mol. Its IUPAC name is 1-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-[4-[diethoxyphosphoryl(fluoro)methyl]sulfonylphenyl]ethanone.
| Compound Name | 1-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-[4-[diethoxyphosphoryl(fluoro)methyl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 158355385 |
| Molecular Formula | C24H27FN3O6PS |
| Molecular Weight | 535.53 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | 1-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-[4-[diethoxyphosphoryl(fluoro)methyl]sulfonylphenyl]ethanone |
| SMILES | CCOP(=O)(OCC)C(F)S(=O)(=O)c1ccc(CC(=O)c2nc(-c3ccc(C)cc3)cnc2N)cc1 |
| InChI | InChI=1S/C24H27FN3O6PS/c1-4-33-35(30,34-5-2)24(25)36(31,32)19-12-8-17(9-13-19)14-21(29)22-23(26)27-15-20(28-22)18-10-6-16(3)7-11-18/h6-13,15,24H,4-5,14H2,1-3H3,(H2,26,27) |
| InChIKey | GSURJCCCDDVGJJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|