C40H47FN6O12 — CID 158357377
tert-butyl 2-aminoacetate;tert-butyl 2-[[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetate;5-fluoro-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 158357377) has the molecular formula C40H47FN6O12 and a molecular weight of 822.84 g/mol. Its IUPAC name is tert-butyl 2-aminoacetate;tert-butyl 2-[[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetate;5-fluoro-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | tert-butyl 2-aminoacetate;tert-butyl 2-[[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetate;5-fluoro-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 158357377 |
| Molecular Formula | C40H47FN6O12 |
| Molecular Weight | 822.84 g/mol |
| Exact Mass | 822.32 |
| IUPAC Name | tert-butyl 2-aminoacetate;tert-butyl 2-[[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]acetate;5-fluoro-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC(C)(C)OC(=O)CN.CN1C(=O)CCC(N2C(=O)c3ccc(F)cc3C2=O)C1=O.CN1C(=O)CCC(N2C(=O)c3ccc(NCC(=O)OC(C)(C)C)cc3C2=O)C1=O |
| InChI | InChI=1S/C20H23N3O6.C14H11FN2O4.C6H13NO2/c1-20(2,3)29-16(25)10-21-11-5-6-12-13(9-11)18(27)23(17(12)26)14-7-8-15(24)22(4)19(14)28;1-16-11(18)5-4-10(14(16)21)17-12(19)8-3-2-7(15)6-9(8)13(17)20;1-6(2,3)9-5(8)4-7/h5-6,9,14,21H,7-8,10H2,1-4H3;2-3,6,10H,4-5H2,1H3;4,7H2,1-3H3 |
| InChIKey | GTAVBABZYOFNPC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 240.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|