C26H28F3N7 — CID 158357837
2-methyl-3-[(1R)-1-[[4-methyl-7-[(1R,4R)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrido[3,4-d]pyridazin-1-yl]amino]ethyl]benzonitrile (PubChem CID 158357837) has the molecular formula C26H28F3N7 and a molecular weight of 495.55 g/mol. Its IUPAC name is 2-methyl-3-[(1R)-1-[[4-methyl-7-[(1R,4R)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrido[3,4-d]pyridazin-1-yl]amino]ethyl]benzonitrile.
| Compound Name | 2-methyl-3-[(1R)-1-[[4-methyl-7-[(1R,4R)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrido[3,4-d]pyridazin-1-yl]amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 158357837 |
| Molecular Formula | C26H28F3N7 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 2-methyl-3-[(1R)-1-[[4-methyl-7-[(1R,4R)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrido[3,4-d]pyridazin-1-yl]amino]ethyl]benzonitrile |
| SMILES | Cc1c(C#N)cccc1[C@@H](C)Nc1nnc(C)c2cnc(N3C[C@H]4CC[C@@H]3CN4CC(F)(F)F)cc12 |
| InChI | InChI=1S/C26H28F3N7/c1-15-18(10-30)5-4-6-21(15)16(2)32-25-22-9-24(31-11-23(22)17(3)33-34-25)36-13-19-7-8-20(36)12-35(19)14-26(27,28)29/h4-6,9,11,16,19-20H,7-8,12-14H2,1-3H3,(H,32,34)/t16-,19-,20-/m1/s1 |
| InChIKey | GTCGGHUTLPJLEM-NSISKUIASA-N |
| XLogP | 4.90 |
| TPSA | 80.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |