About 1,4-dimethylimidazole;1-methyl-5-nitroimidazole
1,4-dimethylimidazole;1-methyl-5-nitroimidazole (PubChem CID 158359273) has the molecular formula C9H13N5O2
and a molecular weight of 223.24 g/mol. Its IUPAC name is 1,4-dimethylimidazole;1-methyl-5-nitroimidazole.
Molecular Properties
| Compound Name | 1,4-dimethylimidazole;1-methyl-5-nitroimidazole |
| PubChem CID | 158359273 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1,4-dimethylimidazole;1-methyl-5-nitroimidazole |
| SMILES | Cc1cn(C)cn1.Cn1cncc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H8N2.C4H5N3O2/c1-5-3-7(2)4-6-5;1-6-3-5-2-4(6)7(8)9/h3-4H,1-2H3;2-3H,1H3 |
| InChIKey | GTGOXXWKOFDLSM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethylimidazole;1-methyl-5-nitroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylimidazole;1-methyl-5-nitroimidazole?
The IUPAC name of 1,4-dimethylimidazole;1-methyl-5-nitroimidazole (CID 158359273) is 1,4-dimethylimidazole;1-methyl-5-nitroimidazole.
What is the SMILES notation for 1,4-dimethylimidazole;1-methyl-5-nitroimidazole?
The canonical SMILES for 1,4-dimethylimidazole;1-methyl-5-nitroimidazole is Cc1cn(C)cn1.Cn1cncc1[N+](=O)[O-].
What is the InChIKey of 1,4-dimethylimidazole;1-methyl-5-nitroimidazole?
The InChIKey is GTGOXXWKOFDLSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.C4H5N3O2/c1-5-3-7(2)4-6-5;1-6-3-5-2-4(6)7(8)9/h3-4H,1-2H3;2-3H,1H3.
What are the key properties of 1,4-dimethylimidazole;1-methyl-5-nitroimidazole?
1,4-dimethylimidazole;1-methyl-5-nitroimidazole has a molecular weight of 223.24 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylimidazole;1-methyl-5-nitroimidazole is sourced from PubChem (CID 158359273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).