C12H20Si2 — CID 15835930
1,1,4,4-tetramethyl-1,4-disilacyclodeca-5,9-diyne (PubChem CID 15835930) has the molecular formula C12H20Si2 and a molecular weight of 220.46 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-1,4-disilacyclodeca-5,9-diyne.
| Compound Name | 1,1,4,4-tetramethyl-1,4-disilacyclodeca-5,9-diyne |
|---|---|
| PubChem CID | 15835930 |
| Molecular Formula | C12H20Si2 |
| Molecular Weight | 220.46 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1,1,4,4-tetramethyl-1,4-disilacyclodeca-5,9-diyne |
| SMILES | C[Si]1(C)C#CCCC#C[Si](C)(C)CC1 |
| InChI | InChI=1S/C12H20Si2/c1-13(2)9-7-5-6-8-10-14(3,4)12-11-13/h5-6,11-12H2,1-4H3 |
| InChIKey | RXQSBHBGJKSHNS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|