C20H21FN4O3 — CID 158359676
(1S,2S,3S,5R)-3-(4-amino-3-fluoropyrrolo[2,3-b]pyridin-1-yl)-5-(2,3-dihydro-1H-isoindol-4-yloxy)cyclopentane-1,2-diol (PubChem CID 158359676) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is (1S,2S,3S,5R)-3-(4-amino-3-fluoropyrrolo[2,3-b]pyridin-1-yl)-5-(2,3-dihydro-1H-isoindol-4-yloxy)cyclopentane-1,2-diol.
| Compound Name | (1S,2S,3S,5R)-3-(4-amino-3-fluoropyrrolo[2,3-b]pyridin-1-yl)-5-(2,3-dihydro-1H-isoindol-4-yloxy)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 158359676 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (1S,2S,3S,5R)-3-(4-amino-3-fluoropyrrolo[2,3-b]pyridin-1-yl)-5-(2,3-dihydro-1H-isoindol-4-yloxy)cyclopentane-1,2-diol |
| SMILES | Nc1ccnc2c1c(F)cn2[C@H]1C[C@@H](Oc2cccc3c2CNC3)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H21FN4O3/c21-12-9-25(20-17(12)13(22)4-5-24-20)14-6-16(19(27)18(14)26)28-15-3-1-2-10-7-23-8-11(10)15/h1-5,9,14,16,18-19,23,26-27H,6-8H2,(H2,22,24)/t14-,16+,18-,19+/m0/s1 |
| InChIKey | FRMYZGILGAUQSX-QNDJGXFYSA-N |
| XLogP | 1.48 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |