C41H50 — CID 158359855
(4aS,11R,11aS,12S,12aS)-11-[(4-but-1-en-2-ylphenyl)methyl]-2,4a,5,7,11a,12,12a-heptamethyl-4,6-dimethylidene-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene (PubChem CID 158359855) has the molecular formula C41H50 and a molecular weight of 542.85 g/mol. Its IUPAC name is (4aS,11R,11aS,12S,12aS)-11-[(4-but-1-en-2-ylphenyl)methyl]-2,4a,5,7,11a,12,12a-heptamethyl-4,6-dimethylidene-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene.
| Compound Name | (4aS,11R,11aS,12S,12aS)-11-[(4-but-1-en-2-ylphenyl)methyl]-2,4a,5,7,11a,12,12a-heptamethyl-4,6-dimethylidene-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene |
|---|---|
| PubChem CID | 158359855 |
| Molecular Formula | C41H50 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.39 |
| IUPAC Name | (4aS,11R,11aS,12S,12aS)-11-[(4-but-1-en-2-ylphenyl)methyl]-2,4a,5,7,11a,12,12a-heptamethyl-4,6-dimethylidene-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene |
| SMILES | C=C(C)C1=C(C)C[C@@]2(C)[C@H](C)[C@]3(C)C(=C(C)[C@@]2(C)C1=C)C(=C)c1c(C)cccc1[C@H]3Cc1ccc(C(=C)CC)cc1 |
| InChI | InChI=1S/C41H50/c1-14-25(4)33-20-18-32(19-21-33)22-35-34-17-15-16-26(5)37(34)28(7)38-30(9)41(13)29(8)36(24(2)3)27(6)23-39(41,11)31(10)40(35,38)12/h15-21,31,35H,2,4,7-8,14,22-23H2,1,3,5-6,9-13H3/t31-,35+,39-,40-,41+/m0/s1 |
| InChIKey | GTIJIBUVNSGCSP-TURAMOHYSA-N |
| XLogP | 11.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |