C26H44O8Si — CID 15836047
(1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4,12,15-pentahydroxy-10,14,17,17-tetramethyl-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 15836047) has the molecular formula C26H44O8Si and a molecular weight of 512.72 g/mol. Its IUPAC name is (1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4,12,15-pentahydroxy-10,14,17,17-tetramethyl-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4,12,15-pentahydroxy-10,14,17,17-tetramethyl-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 15836047 |
| Molecular Formula | C26H44O8Si |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4,12,15-pentahydroxy-10,14,17,17-tetramethyl-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H]2OC[C@@]2(O)[C@H]2[C@H](O)[C@]3(O)C[C@H](O)C(C)=C([C@@H](O)C(=O)[C@]12C)C3(C)C |
| InChI | InChI=1S/C26H44O8Si/c1-8-35(9-2,10-3)34-16-11-17-25(31,13-33-17)20-22(30)26(32)12-15(27)14(4)18(23(26,5)6)19(28)21(29)24(16,20)7/h15-17,19-20,22,27-28,30-32H,8-13H2,1-7H3/t15-,16-,17+,19+,20-,22-,24+,25-,26+/m0/s1 |
| InChIKey | LYCQEDXVUZYYDR-JGYABYCJSA-N |
| XLogP | 1.68 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|