About 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane
4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane (PubChem CID 158361077) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane.
Molecular Properties
| Compound Name | 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane |
| PubChem CID | 158361077 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane |
| SMILES | C.CC.CC(C)c1cnoc1C(C)C |
| InChI | InChI=1S/C9H15NO.C2H6.CH4/c1-6(2)8-5-10-11-9(8)7(3)4;1-2;/h5-7H,1-4H3;1-2H3;1H4 |
| InChIKey | GTMAYGJKYVFKKZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane?
The IUPAC name of 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane (CID 158361077) is 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane.
What is the SMILES notation for 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane?
The canonical SMILES for 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane is C.CC.CC(C)c1cnoc1C(C)C.
What is the InChIKey of 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane?
The InChIKey is GTMAYGJKYVFKKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO.C2H6.CH4/c1-6(2)8-5-10-11-9(8)7(3)4;1-2;/h5-7H,1-4H3;1-2H3;1H4.
What are the key properties of 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane?
4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane has a molecular weight of 199.34 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-di(propan-2-yl)-1,2-oxazole;ethane;methane is sourced from PubChem (CID 158361077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).