C23H46O6Si2 — CID 158362036
(3aS,4R,7R,8R,8aS)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-6-one (PubChem CID 158362036) has the molecular formula C23H46O6Si2 and a molecular weight of 474.79 g/mol. Its IUPAC name is (3aS,4R,7R,8R,8aS)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-6-one.
| Compound Name | (3aS,4R,7R,8R,8aS)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-6-one |
|---|---|
| PubChem CID | 158362036 |
| Molecular Formula | C23H46O6Si2 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (3aS,4R,7R,8R,8aS)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-2,2-dimethyl-4,7,8,8a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]oxepin-6-one |
| SMILES | CC[C@H]1OC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C23H46O6Si2/c1-14-15-16-17(27-23(8,9)26-16)18(28-30(10,11)21(2,3)4)19(20(24)25-15)29-31(12,13)22(5,6)7/h15-19H,14H2,1-13H3/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | HYHLVLBHIIRFQF-ICBNADEASA-N |
| XLogP | 5.62 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|