C33H45NO6Si — CID 158362401
2-[2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R,5S)-5-ethenyl-4-[(4-methoxyphenyl)methoxymethyl]-3-methyloxolan-2-yl]propyl]isoindole-1,3-dione (PubChem CID 158362401) has the molecular formula C33H45NO6Si and a molecular weight of 579.81 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R,5S)-5-ethenyl-4-[(4-methoxyphenyl)methoxymethyl]-3-methyloxolan-2-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R,5S)-5-ethenyl-4-[(4-methoxyphenyl)methoxymethyl]-3-methyloxolan-2-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158362401 |
| Molecular Formula | C33H45NO6Si |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R,5S)-5-ethenyl-4-[(4-methoxyphenyl)methoxymethyl]-3-methyloxolan-2-yl]propyl]isoindole-1,3-dione |
| SMILES | C=C[C@@H]1O[C@H](CC(CN2C(=O)c3ccccc3C2=O)O[Si](C)(C)C(C)(C)C)[C@H](C)C1COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C33H45NO6Si/c1-9-29-28(21-38-20-23-14-16-24(37-6)17-15-23)22(2)30(39-29)18-25(40-41(7,8)33(3,4)5)19-34-31(35)26-12-10-11-13-27(26)32(34)36/h9-17,22,25,28-30H,1,18-21H2,2-8H3/t22-,25?,28?,29+,30-/m1/s1 |
| InChIKey | GTKARJWIQFHMPW-AQCKGPIFSA-N |
| XLogP | 6.49 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|