About 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide
2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide (PubChem CID 15836328) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide.
Molecular Properties
| Compound Name | 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide |
| PubChem CID | 15836328 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide |
| SMILES | C=C(C)/C=C/NC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H17NO/c1-8(2)6-7-11-9(12)10(3,4)5/h6-7H,1H2,2-5H3,(H,11,12)/b7-6+ |
| InChIKey | DMAKEGCBCXFYPB-VOTSOKGWSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide?
The IUPAC name of 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide (CID 15836328) is 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide.
What is the SMILES notation for 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide?
The canonical SMILES for 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide is C=C(C)/C=C/NC(=O)C(C)(C)C.
What is the InChIKey of 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide?
The InChIKey is DMAKEGCBCXFYPB-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H17NO/c1-8(2)6-7-11-9(12)10(3,4)5/h6-7H,1H2,2-5H3,(H,11,12)/b7-6+.
What are the key properties of 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide?
2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide has a molecular weight of 167.25 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]propanamide is sourced from PubChem (CID 15836328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).