About 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine
8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine (PubChem CID 158364735) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine.
Molecular Properties
| Compound Name | 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine |
| PubChem CID | 158364735 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine |
| SMILES | CCCCCC(N)CC.CN1C2CCC1CC(=O)C2 |
| InChI | InChI=1S/C8H13NO.C8H19N/c1-9-6-2-3-7(9)5-8(10)4-6;1-3-5-6-7-8(9)4-2/h6-7H,2-5H2,1H3;8H,3-7,9H2,1-2H3 |
| InChIKey | GTWXEOITZCXSRW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine?
The IUPAC name of 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine (CID 158364735) is 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine.
What is the SMILES notation for 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine?
The canonical SMILES for 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine is CCCCCC(N)CC.CN1C2CCC1CC(=O)C2.
What is the InChIKey of 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine?
The InChIKey is GTWXEOITZCXSRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.C8H19N/c1-9-6-2-3-7(9)5-8(10)4-6;1-3-5-6-7-8(9)4-2/h6-7H,2-5H2,1H3;8H,3-7,9H2,1-2H3.
What are the key properties of 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine?
8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine has a molecular weight of 268.44 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-8-azabicyclo[3.2.1]octan-3-one;octan-3-amine is sourced from PubChem (CID 158364735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).