About methane;5-propan-2-yl-1,3-oxazinane-2,4-dione
methane;5-propan-2-yl-1,3-oxazinane-2,4-dione (PubChem CID 158364746) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is methane;5-propan-2-yl-1,3-oxazinane-2,4-dione.
Molecular Properties
| Compound Name | methane;5-propan-2-yl-1,3-oxazinane-2,4-dione |
| PubChem CID | 158364746 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | methane;5-propan-2-yl-1,3-oxazinane-2,4-dione |
| SMILES | C.CC(C)C1COC(=O)NC1=O |
| InChI | InChI=1S/C7H11NO3.CH4/c1-4(2)5-3-11-7(10)8-6(5)9;/h4-5H,3H2,1-2H3,(H,8,9,10);1H4 |
| InChIKey | GTWYHGLXRIYMNY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;5-propan-2-yl-1,3-oxazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-propan-2-yl-1,3-oxazinane-2,4-dione?
The IUPAC name of methane;5-propan-2-yl-1,3-oxazinane-2,4-dione (CID 158364746) is methane;5-propan-2-yl-1,3-oxazinane-2,4-dione.
What is the SMILES notation for methane;5-propan-2-yl-1,3-oxazinane-2,4-dione?
The canonical SMILES for methane;5-propan-2-yl-1,3-oxazinane-2,4-dione is C.CC(C)C1COC(=O)NC1=O.
What is the InChIKey of methane;5-propan-2-yl-1,3-oxazinane-2,4-dione?
The InChIKey is GTWYHGLXRIYMNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3.CH4/c1-4(2)5-3-11-7(10)8-6(5)9;/h4-5H,3H2,1-2H3,(H,8,9,10);1H4.
What are the key properties of methane;5-propan-2-yl-1,3-oxazinane-2,4-dione?
methane;5-propan-2-yl-1,3-oxazinane-2,4-dione has a molecular weight of 173.21 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-propan-2-yl-1,3-oxazinane-2,4-dione is sourced from PubChem (CID 158364746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).