C37H41FN2O3 — CID 158365159
(5R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-5-(2-fluoro-5-pentylphenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine (PubChem CID 158365159) has the molecular formula C37H41FN2O3 and a molecular weight of 580.74 g/mol. Its IUPAC name is (5R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-5-(2-fluoro-5-pentylphenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine.
| Compound Name | (5R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-5-(2-fluoro-5-pentylphenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine |
|---|---|
| PubChem CID | 158365159 |
| Molecular Formula | C37H41FN2O3 |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | (5R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-5-(2-fluoro-5-pentylphenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine |
| SMILES | CCCCCc1ccc(F)c([C@]2(C)COCC(NC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)=N2)c1 |
| InChI | InChI=1S/C37H41FN2O3/c1-5-6-8-11-27-14-23-34(38)33(24-27)36(2)26-43-25-35(39-36)40-37(28-12-9-7-10-13-28,29-15-19-31(41-3)20-16-29)30-17-21-32(42-4)22-18-30/h7,9-10,12-24H,5-6,8,11,25-26H2,1-4H3,(H,39,40)/t36-/m0/s1 |
| InChIKey | GTYDWTAUFVLDEF-BHVANESWSA-N |
| XLogP | 7.80 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|