C23H27N3O5 — CID 158365635
2-(1-benzyl-2-ethyl-5-methoxy-2-methyl-3H-indol-3-yl)-2-oxoacetamide;2-oxoacetamide (PubChem CID 158365635) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-(1-benzyl-2-ethyl-5-methoxy-2-methyl-3H-indol-3-yl)-2-oxoacetamide;2-oxoacetamide.
| Compound Name | 2-(1-benzyl-2-ethyl-5-methoxy-2-methyl-3H-indol-3-yl)-2-oxoacetamide;2-oxoacetamide |
|---|---|
| PubChem CID | 158365635 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-(1-benzyl-2-ethyl-5-methoxy-2-methyl-3H-indol-3-yl)-2-oxoacetamide;2-oxoacetamide |
| SMILES | CCC1(C)C(C(=O)C(N)=O)c2cc(OC)ccc2N1Cc1ccccc1.NC(=O)C=O |
| InChI | InChI=1S/C21H24N2O3.C2H3NO2/c1-4-21(2)18(19(24)20(22)25)16-12-15(26-3)10-11-17(16)23(21)13-14-8-6-5-7-9-14;3-2(5)1-4/h5-12,18H,4,13H2,1-3H3,(H2,22,25);1H,(H2,3,5) |
| InChIKey | GTZLVNOKNBGRLG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|