C6H10N6O2S — CID 158366249
2-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methylsulfanyl]acetic acid (PubChem CID 158366249) has the molecular formula C6H10N6O2S and a molecular weight of 230.25 g/mol. Its IUPAC name is 2-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methylsulfanyl]acetic acid.
| Compound Name | 2-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 158366249 |
| Molecular Formula | C6H10N6O2S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methylsulfanyl]acetic acid |
| SMILES | Nc1nc(N)nc(NCSCC(=O)O)n1 |
| InChI | InChI=1S/C6H10N6O2S/c7-4-10-5(8)12-6(11-4)9-2-15-1-3(13)14/h1-2H2,(H,13,14)(H5,7,8,9,10,11,12) |
| InChIKey | GUBIGSAHBKSANN-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 140.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|