About 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one
2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one (PubChem CID 158368253) has the molecular formula C13H21F2NO3
and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one.
Molecular Properties
| Compound Name | 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one |
| PubChem CID | 158368253 |
| Molecular Formula | C13H21F2NO3 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one |
| SMILES | CC(=O)C(F)=C(C)C.CON(C)C(=O)C(F)=C(C)C |
| InChI | InChI=1S/C7H12FNO2.C6H9FO/c1-5(2)6(8)7(10)9(3)11-4;1-4(2)6(7)5(3)8/h1-4H3;1-3H3 |
| InChIKey | GUHGCOOJAUMXJI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one?
The IUPAC name of 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one (CID 158368253) is 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one.
What is the SMILES notation for 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one?
The canonical SMILES for 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one is CC(=O)C(F)=C(C)C.CON(C)C(=O)C(F)=C(C)C.
What is the InChIKey of 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one?
The InChIKey is GUHGCOOJAUMXJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FNO2.C6H9FO/c1-5(2)6(8)7(10)9(3)11-4;1-4(2)6(7)5(3)8/h1-4H3;1-3H3.
What are the key properties of 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one?
2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one has a molecular weight of 277.31 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-methoxy-N,3-dimethylbut-2-enamide;3-fluoro-4-methylpent-3-en-2-one is sourced from PubChem (CID 158368253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).