C14H12ClN2OY- — CID 158369037
2-[4-(5-chloro-6-methylidene-1,3,4,5-tetrahydropyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium (PubChem CID 158369037) has the molecular formula C14H12ClN2OY- and a molecular weight of 348.62 g/mol. Its IUPAC name is 2-[4-(5-chloro-6-methylidene-1,3,4,5-tetrahydropyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium.
| Compound Name | 2-[4-(5-chloro-6-methylidene-1,3,4,5-tetrahydropyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium |
|---|---|
| PubChem CID | 158369037 |
| Molecular Formula | C14H12ClN2OY- |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 2-[4-(5-chloro-6-methylidene-1,3,4,5-tetrahydropyridin-3-id-2-yl)phenoxy]acetonitrile;yttrium |
| SMILES | C=C1NC(c2ccc(OCC#N)cc2)=[C-]CC1Cl.[Y] |
| InChI | InChI=1S/C14H12ClN2O.Y/c1-10-13(15)6-7-14(17-10)11-2-4-12(5-3-11)18-9-8-16;/h2-5,13,17H,1,6,9H2;/q-1; |
| InChIKey | FQURUIHPGZVJJR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|