About (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane
(5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane (PubChem CID 158369284) has the molecular formula C22H31N3O3S
and a molecular weight of 417.58 g/mol. Its IUPAC name is (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane.
Molecular Properties
| Compound Name | (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane |
| PubChem CID | 158369284 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane |
| SMILES | C1COCCN1.O=C1NC[C@@H](CN(Cc2ccccc2)Cc2ccccc2)O1.S |
| InChI | InChI=1S/C18H20N2O2.C4H9NO.H2S/c21-18-19-11-17(22-18)14-20(12-15-7-3-1-4-8-15)13-16-9-5-2-6-10-16;1-3-6-4-2-5-1;/h1-10,17H,11-14H2,(H,19,21);5H,1-4H2;1H2/t17-;;/m0../s1 |
| InChIKey | GUKLIVXIUBHUJS-RMRYJAPISA-N |
| XLogP | 2.52 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane?
The IUPAC name of (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane (CID 158369284) is (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane.
What is the SMILES notation for (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane?
The canonical SMILES for (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane is C1COCCN1.O=C1NC[C@@H](CN(Cc2ccccc2)Cc2ccccc2)O1.S.
What is the InChIKey of (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane?
The InChIKey is GUKLIVXIUBHUJS-RMRYJAPISA-N. The full InChI is InChI=1S/C18H20N2O2.C4H9NO.H2S/c21-18-19-11-17(22-18)14-20(12-15-7-3-1-4-8-15)13-16-9-5-2-6-10-16;1-3-6-4-2-5-1;/h1-10,17H,11-14H2,(H,19,21);5H,1-4H2;1H2/t17-;;/m0../s1.
What are the key properties of (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane?
(5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane has a molecular weight of 417.58 g/mol, XLogP of 2.52, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[(dibenzylamino)methyl]-1,3-oxazolidin-2-one;morpholine;sulfane is sourced from PubChem (CID 158369284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).